CymitQuimica logo

CAS 873652-48-3

:

GDC-0152

Description:
GDC-0152, with the CAS number 873652-48-3, is a small molecule inhibitor primarily known for its role as a selective antagonist of the protein MDM2 (mouse double minute 2 homolog). This compound is notable for its potential therapeutic applications in cancer treatment, particularly in tumors that express the p53 protein. By inhibiting MDM2, GDC-0152 can restore the function of p53, a crucial tumor suppressor that regulates the cell cycle and promotes apoptosis in response to cellular stress or DNA damage. The compound is characterized by its ability to disrupt the MDM2-p53 interaction, thereby enhancing p53-mediated transcriptional activity. In preclinical studies, GDC-0152 has demonstrated efficacy in various cancer models, leading to increased apoptosis and reduced tumor growth. Its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion, are essential for determining its suitability for clinical use. As research continues, GDC-0152 represents a promising avenue in targeted cancer therapy, particularly for malignancies with dysfunctional p53 pathways.
Formula:C25H34N6O3S
InChI:InChI=1S/C25H34N6O3S/c1-16(26-2)22(32)27-21(18-12-7-4-8-13-18)25(34)31-15-9-14-19(31)23(33)28-24-20(29-30-35-24)17-10-5-3-6-11-17/h3,5-6,10-11,16,18-19,21,26H,4,7-9,12-15H2,1-2H3,(H,27,32)(H,28,33)/t16-,19-,21-/m0/s1
InChI key:WZRFLSDVFPIXOV-LRQRDZAKSA-N
SMILES:C[C@@H](C(=O)N[C@@H](C1CCCCC1)C(=O)N2CCC[C@H]2C(=O)NC3=C(N=NS3)C4=CC=CC=C4)NC
Found 5 products.