CymitQuimica logo

CAS 873786-09-5

:

PLX-647

Description:
PLX-647, with the CAS number 873786-09-5, is a small molecule inhibitor primarily known for its role in targeting the immune checkpoint protein PD-1 (programmed cell death protein 1). This compound is part of a broader class of immunotherapeutic agents that aim to enhance the immune system's ability to fight cancer by blocking the interaction between PD-1 and its ligands, PD-L1 and PD-L2. PLX-647 exhibits characteristics typical of small molecule inhibitors, including a relatively low molecular weight and the ability to penetrate cell membranes effectively. Its chemical structure includes specific functional groups that facilitate binding to the target protein, thereby modulating immune responses. Research has indicated that PLX-647 may have potential applications in cancer therapy, particularly in combination with other treatments to improve efficacy. However, as with many investigational drugs, ongoing studies are essential to fully understand its pharmacokinetics, safety profile, and therapeutic potential in clinical settings.
Formula:C21H17F3N4
InChI:InChI=1S/C21H17F3N4/c22-21(23,24)17-6-3-14(4-7-17)11-26-19-8-5-15(12-27-19)10-16-13-28-20-18(16)2-1-9-25-20/h1-9,12-13H,10-11H2,(H,25,28)(H,26,27)
InChI key:NODCQQSEMCESEC-UHFFFAOYSA-N
SMILES:C1=CC2=C(NC=C2CC3=CN=C(C=C3)NCC4=CC=C(C=C4)C(F)(F)F)N=C1
Found 4 products.