CAS 874-43-1
:5-Pyrimidinemethanamine, 4-amino-2-methyl-, hydrochloride (1:2)
Description:
5-Pyrimidinemethanamine, 4-amino-2-methyl-, hydrochloride (1:2), commonly referred to by its CAS number 874-43-1, is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features an amino group and a methyl group at specific positions on the pyrimidine ring, contributing to its basicity and potential reactivity. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water, making it useful in various applications, including pharmaceuticals and biochemistry. The presence of the amino group suggests that it can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. Its biological activity may be linked to its structural similarity to nucleobases, which could influence its interaction with biological systems. Overall, this compound is of interest in medicinal chemistry and research due to its unique structural features and potential applications.
Formula:C6H10N4·2ClH
InChI:InChI=1S/C6H10N4.2ClH/c1-4-9-3-5(2-7)6(8)10-4;;/h3H,2,7H2,1H3,(H2,8,9,10);2*1H
InChI key:InChIKey=FRWHCPFBMJIPLY-UHFFFAOYSA-N
SMILES:C(N)C=1C(N)=NC(C)=NC1.Cl
Synonyms:- 5-(Aminomethyl)-2-Methylpyrimidin-4-Amine
- 5-(Aminomethyl)-2-Methylpyrimidin-4-Amine Dihydrochloride
- 5-Pyrimidinemethanamine, 4-amino-2-methyl-, dihydrochloride
- 5-Pyrimidinemethanamine, 4-amino-2-methyl-, hydrochloride (1:2)
- Pyrimidine, 4-amino-5-(aminomethyl)-2-methyl-, dihydrochloride
- 5-Aminomethyl-2-methylpyrimidin-4-ylamine dihydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-(Aminomethyl)-2-methylpyrimidin-4-amine dihydrochloride
CAS:5-(Aminomethyl)-2-methylpyrimidin-4-amine dihydrochlorideFormula:C6H12Cl2N4Purity:98%Molecular weight:211.095-aminomethyl-2-methylpyrimidin-4-ylamine dihydrochloride
CAS:Formula:C6H12Cl2N4Purity:95%Color and Shape:SolidMolecular weight:211.09234-Amino-5-aminomethyl-2-methylpyrimidine Dihydrochloride
CAS:Controlled ProductApplications Substrate for TenA enzyme in the thiamin salvage pathway
References Jenkins, A., et al.: Nat. Chem. Biol., 3, 492 (2007), Jenkins, A., et al.: Bioorg. Chem., 36, 29 (2008),Formula:C6H10N4·2ClHColor and Shape:NeatMolecular weight:211.094-Amino-5-aminomethyl-2-methylpyrimidine dihydrochloride
CAS:4-Amino-5-aminomethyl-2-methylpyrimidine dihydrochloride is a vitamin B1 derivative that is biosynthesized by marine algal cells. It is active at high concentrations, and has been shown to have an interaction with the active site residues of hydrogen chloride. This analog has been used in genomic analyses and can be detected by mass spectrometry. It also has the ability to inhibit the growth of phytoplankton, which are microscopic plants living near the surface of water. The concentration of 4-amino-5-aminomethyl-2-methylpyrimidine dihydrochloride in seawater can be determined using a constant scaling factor based on plankton biomass.Formula:C6H10N4•(HCl)2Purity:Min. 95%Color and Shape:Slightly Yellow PowderMolecular weight:211.09 g/mol




