CAS 87407-12-3
:3-(Trifluoromethyl)pyridine-2-carboxylic acid
Description:
3-(Trifluoromethyl)pyridine-2-carboxylic acid is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a trifluoromethyl group (-CF3) at the 3-position of the pyridine ring significantly influences its chemical properties, enhancing its lipophilicity and potentially its biological activity. The carboxylic acid functional group (-COOH) at the 2-position contributes to its acidity and reactivity, allowing for various chemical transformations and interactions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique electronic properties, derived from the trifluoromethyl group, can also affect its reactivity and interactions with biological targets. Additionally, the compound's solubility and stability in different solvents can vary, making it important to consider these factors in practical applications. Overall, 3-(Trifluoromethyl)pyridine-2-carboxylic acid is a versatile compound with significant implications in chemical research and development.
Formula:C7H4F3NO2
InChI:InChI=1/C7H4F3NO2/c8-7(9,10)4-2-1-3-11-5(4)6(12)13/h1-3H,(H,12,13)
SMILES:c1cc(c(C(=O)O)nc1)C(F)(F)F
Synonyms:- 2-Pyridinecarboxylic acid, 3-(trifluoromethyl)-
- 3-Trifluoromethyl-pyridine-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-(Trifluoromethyl)pyridine-2-carboxylic Acid
CAS:Formula:C7H4F3NO2Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:191.113-(Trifluoromethyl)pyridine-2-carboxylic acid
CAS:3-(Trifluoromethyl)pyridine-2-carboxylic acidFormula:C7H4F3NO2Purity:97%Color and Shape:Solid-PowderMolecular weight:191.107363-Trifluoromethylpicolinic acid
CAS:Formula:C7H4F3NO2Purity:97%Color and Shape:SolidMolecular weight:191.10743-(Trifluoromethyl)pyridine-2-carboxylic acid
CAS:Formula:C7H4F3NO2Purity:97%Color and Shape:Solid, CrystallineMolecular weight:191.1093-(Trifluoromethyl)-2-picolinic Acid
CAS:Controlled ProductApplications Picolinic acid (P437220) derivative used in the synthesis of oxazine derivatives that act as BACE inhibitors for treatment of diabetes and neurological disorders.
Formula:C7H4F3NO2Color and Shape:NeatMolecular weight:191.11





