CymitQuimica logo

CAS 87411-38-9

:

Pentanoic acid, 5-(4-bromophenoxy)-

Description:
Pentanoic acid, 5-(4-bromophenoxy)-, is an organic compound characterized by its carboxylic acid functional group and a phenoxy substituent. The presence of the pentanoic acid backbone indicates that it has a five-carbon straight-chain structure, which contributes to its hydrophobic properties. The 4-bromophenoxy group introduces a bromine atom and a phenyl ether moiety, enhancing the compound's potential for various chemical interactions and applications. This compound is likely to exhibit moderate solubility in organic solvents while being less soluble in water due to its hydrophobic characteristics. The bromine substituent can influence the compound's reactivity, making it a candidate for further chemical modifications or reactions. Additionally, pentanoic acid derivatives are often studied for their potential applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity and environmental impact.
Formula:C11H13BrO3
InChI:InChI=1S/C11H13BrO3/c12-9-4-6-10(7-5-9)15-8-2-1-3-11(13)14/h4-7H,1-3,8H2,(H,13,14)
InChI key:KACNEIIGTGEGPZ-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1OCCCCC(=O)O)Br
Found 5 products.