CymitQuimica logo

CAS 874196-94-8

:

1H-Pyrazole-4-carboxylic acid, 1-(2-methoxyethyl)-

Description:
1H-Pyrazole-4-carboxylic acid, 1-(2-methoxyethyl)- is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a carboxylic acid functional group at the 4-position of the pyrazole ring, contributing to its acidic properties. The presence of a 2-methoxyethyl substituent at the 1-position enhances its solubility and may influence its biological activity. Typically, compounds like this can exhibit a range of pharmacological properties, making them of interest in medicinal chemistry. The molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, the compound's stability, reactivity, and solubility in various solvents are influenced by its functional groups. As with many pyrazole derivatives, it may also participate in various chemical reactions, including esterification and amidation, which are relevant in synthetic organic chemistry. Overall, this compound represents a versatile scaffold for further chemical modifications and potential applications in drug development.
Formula:C7H10N2O3
InChI:InChI=1S/C7H10N2O3/c1-12-3-2-9-5-6(4-8-9)7(10)11/h4-5H,2-3H2,1H3,(H,10,11)
InChI key:BMUGOSJLZCHJKW-UHFFFAOYSA-N
SMILES:COCCN1C=C(C=N1)C(=O)O
Found 4 products.