CymitQuimica logo

CAS 874219-50-8

:

[4-(2-methylpropanoylamino)phenyl]boronic acid

Description:
[4-(2-Methylpropanoylamino)phenyl]boronic acid is an organic compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including drug development and materials science. The compound features an aromatic ring substituted with an amide group, specifically a 2-methylpropanoylamino moiety, which contributes to its biological activity and solubility properties. The boronic acid group enhances its reactivity, allowing it to participate in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in organic synthesis. This compound may exhibit properties such as moderate solubility in polar solvents and potential biological activity, making it of interest in medicinal chemistry. Its structural characteristics suggest it could be involved in interactions with biological targets, potentially leading to applications in therapeutic contexts. As with many boronic acids, care must be taken in handling due to their sensitivity to moisture and air, which can affect their stability and reactivity.
Formula:C10H14BNO3
InChI:InChI=1/C10H14BNO3/c1-7(2)10(13)12-9-5-3-8(4-6-9)11(14)15/h3-7,14-15H,1-2H3,(H,12,13)
InChI key:DBWRRIVRDITVFV-UHFFFAOYSA-N
SMILES:CC(C)C(=O)Nc1ccc(cc1)B(O)O
Found 4 products.