CymitQuimica logo

CAS 874219-59-7

:

3-Borono-4-fluorobenzoic acid

Description:
3-Borono-4-fluorobenzoic acid is an organic compound characterized by the presence of a boronic acid functional group and a fluorine atom attached to a benzene ring. Its molecular structure features a carboxylic acid group (-COOH) and a boron atom bonded to a phenyl ring, which enhances its reactivity in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The fluorine atom introduces unique electronic properties, influencing the compound's reactivity and solubility. Typically, this compound is a white to off-white solid, and it is soluble in polar solvents such as water and alcohols. Its applications extend to pharmaceuticals and agrochemicals, where it serves as an intermediate in the synthesis of more complex molecules. Additionally, the presence of both boron and fluorine in its structure allows for potential applications in materials science and catalysis. Safety data should be consulted for handling, as boronic acids can be sensitive to moisture and may require specific storage conditions.
Formula:C7H6BFO4
InChI:InChI=1S/C7H6BFO4/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3,12-13H,(H,10,11)
InChI key:InChIKey=YLZPFWJYAFZZHF-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC(C(O)=O)=CC=C1F
Synonyms:
  • 2-Fluoro-5-carboxybenzeneboronic acid
  • 2-Fluoro-5-carboxyphenylboronic acid
  • 3-(Dihydroxyboranyl)-4-Fluorobenzoic Acid
  • 3-Borono-4-fluorobenzoic acid
  • Benzoic acid, 3-borono-4-fluoro-
  • 5-Carboxy-2-fluorophenylboronic acid
Found 5 products.