CymitQuimica logo

CAS 874288-12-7

:

[3-(2-chloroethylcarbamoyl)phenyl]boronic acid

Description:
[3-(2-chloroethylcarbamoyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and is widely used in organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a 2-chloroethylcarbamoyl group, which enhances its reactivity and potential biological activity. The presence of the boronic acid moiety allows for participation in Suzuki coupling reactions, making it valuable in the synthesis of complex organic molecules. Additionally, the chloroethyl group may impart specific pharmacological properties, potentially influencing its interactions with biological targets. This compound is typically handled with care due to the presence of the chloro group, which can be reactive. Its applications may extend to drug development, particularly in the design of compounds targeting specific enzymes or receptors. Overall, [3-(2-chloroethylcarbamoyl)phenyl]boronic acid exemplifies the versatility of boronic acids in synthetic and medicinal chemistry.
Formula:C9H11BClNO3
InChI:InChI=1/C9H11BClNO3/c11-4-5-12-9(13)7-2-1-3-8(6-7)10(14)15/h1-3,6,14-15H,4-5H2,(H,12,13)
InChI key:OMDXADHEWANBAK-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)B(O)O)C(=NCCCl)O
Found 3 products.