CymitQuimica logo

CAS 874289-22-2

:

(4-carbamoyl-2-fluoro-phenyl)boronic acid

Description:
(4-Carbamoyl-2-fluoro-phenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that also contains a carbamoyl and a fluorine substituent. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the boronic acid group, which can participate in hydrogen bonding. The fluorine atom introduces electronegativity, potentially influencing the compound's reactivity and interaction with biological targets. Boronic acids are known for their ability to form reversible covalent bonds with diols, making them valuable in various applications, including drug development and materials science. The presence of the carbamoyl group may enhance the compound's stability and solubility, while also contributing to its biological activity. Overall, (4-carbamoyl-2-fluoro-phenyl)boronic acid is a versatile compound with potential applications in medicinal chemistry and organic synthesis, particularly in the development of targeted therapies and molecular probes.
Formula:C7H7BFNO3
InChI:InChI=1/C7H7BFNO3/c9-6-3-4(7(10)11)1-2-5(6)8(12)13/h1-3,12-13H,(H2,10,11)
InChI key:AHUCXBQJEJTERU-UHFFFAOYSA-N
SMILES:c1cc(c(cc1C(=N)O)F)B(O)O
Found 4 products.