CymitQuimica logo

CAS 87436-78-0

:

Phosphonium, (4-hydroxybutyl)triphenyl-, bromide

Description:
Phosphonium, (4-hydroxybutyl)triphenyl-, bromide is a quaternary ammonium salt characterized by its phosphonium cation, which consists of a phosphorus atom bonded to three phenyl groups and a 4-hydroxybutyl group. This compound typically exhibits properties associated with ionic compounds, such as high solubility in polar solvents and the ability to form stable ionic interactions. The presence of the hydroxyl group in the 4-hydroxybutyl moiety imparts hydrophilicity, enhancing its solubility in water and other polar media. The bromide anion contributes to the overall stability of the compound, while also influencing its reactivity. Phosphonium salts are often used in organic synthesis, catalysis, and as phase transfer catalysts due to their ability to facilitate the transfer of ions across interfaces. Additionally, the triphenylphosphonium structure is known for its applications in biological systems, particularly in mitochondrial studies. Safety data should be consulted for handling, as with many chemical substances, to ensure proper precautions are taken.
Formula:C22H24OPBr
InChI:InChI=1S/C22H24OP.BrH/c23-18-10-11-19-24(20-12-4-1-5-13-20,21-14-6-2-7-15-21)22-16-8-3-9-17-22;/h1-9,12-17,23H,10-11,18-19H2;1H/q+1;/p-1
InChI key:NQPXQJXVGAHQJI-UHFFFAOYSA-M
SMILES:C1=CC=C(C=C1)[P+](CCCCO)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-]
Found 2 products.