CymitQuimica logo

CAS 874459-62-8

:

(4-ethoxycarbonyl-2-fluoro-phenyl)boronic acid

Description:
(4-Ethoxycarbonyl-2-fluoro-phenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various organic synthesis applications, particularly in Suzuki coupling reactions. The compound features a phenyl ring substituted with both an ethoxycarbonyl group and a fluorine atom, which can influence its reactivity and solubility. The ethoxycarbonyl group enhances the compound's stability and solubility in organic solvents, while the fluorine atom can affect the electronic properties of the molecule, potentially increasing its acidity and reactivity. This compound is typically used in medicinal chemistry and materials science for the development of pharmaceuticals and advanced materials. Its boronic acid functionality allows for the formation of complex structures, making it a valuable building block in synthetic organic chemistry. Safety and handling precautions should be observed, as with all boronic acids, due to potential reactivity and toxicity.
Formula:C9H10BFO4
InChI:InChI=1/C9H10BFO4/c1-2-15-9(12)6-3-4-7(10(13)14)8(11)5-6/h3-5,13-14H,2H2,1H3
InChI key:HBXIRLABZXFDAX-UHFFFAOYSA-N
SMILES:CCOC(=O)c1ccc(c(c1)F)B(O)O
Synonyms:
  • [4-(Ethoxycarbonyl)-2-fluorophenyl]boronic acid
  • Benzoic Acid, 4-Borono-3-Fluoro-, Ethyl Ester
Found 4 products.