CymitQuimica logo

CAS 874459-75-3

:

Boronic acid,B-[4-[2-(acetylamino)ethyl]phenyl]-

Description:
Boronic acid, specifically B-[4-[2-(acetylamino)ethyl]phenyl]- (CAS 874459-75-3), is an organic compound characterized by the presence of a boron atom bonded to a phenyl group and an acetylaminoethyl substituent. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The acetylamino group enhances its solubility and reactivity, allowing for potential interactions in biological systems. Boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in forming carbon-carbon bonds in the synthesis of complex organic molecules. Additionally, the presence of the acetylamino group may impart specific biological activities, making this compound of interest in drug development and materials science. Overall, the unique structure of this boronic acid derivative positions it as a versatile building block in chemical research and applications.
Formula:C10H14BNO3
InChI:InChI=1S/C10H14BNO3/c1-8(13)12-7-6-9-2-4-10(5-3-9)11(14)15/h2-5,14-15H,6-7H2,1H3,(H,12,13)
InChI key:MASBKHYFMNIEKU-UHFFFAOYSA-N
SMILES:B(C1=CC=C(C=C1)CCNC(=O)C)(O)O
Synonyms:
  • Boronicacid, [4-[2-(acetylamino)ethyl]phenyl]- (9CI)
  • (4-(2-Acetamidoethyl)phenyl)boronicacid
Found 3 products.