CAS 874460-01-2

[3-[benzyl(methyl)carbamoyl]phenyl]boronic acid

Description:

[3-[Benzyl(methyl)carbamoyl]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which typically exhibits properties such as Lewis acidity and the ability to form reversible covalent bonds with diols. This compound features a phenyl ring substituted with a benzyl group and a methyl carbamoyl moiety, contributing to its potential applications in medicinal chemistry and organic synthesis. The boronic acid group allows for participation in Suzuki-Miyaura cross-coupling reactions, making it valuable in the formation of carbon-carbon bonds. Additionally, the presence of the carbamoyl group may enhance its solubility and reactivity in various solvents. The compound's structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Overall, [3-[benzyl(methyl)carbamoyl]phenyl]boronic acid exemplifies the versatility of boronic acids in both synthetic and biological contexts, highlighting their importance in modern chemistry.

Formula: C₁₅H₁₆BNO₃

InChI: InChI=1/C15H16BNO3/c1-17(11-12-6-3-2-4-7-12)15(18)13-8-5-9-14(10-13)16(19)20/h2-10,19-20H,11H2,1H3

InChI key: SZEATPHXIPBXGU-UHFFFAOYSA-N

SMILES: CN(Cc1ccccc1)C(=O)c1cccc(c1)B(O)O

3-[N-Benzyl-N-(methylaminocarbonyl)]benzeneboronic acid

CAS: 874460-01-2

3-[N-Benzyl-N-(methylaminocarbonyl)]benzeneboronic acid

Purity: 97%

Molecular weight: 269.10g/mol

Ref: 54-OR3783