CymitQuimica logo

CAS 874472-98-7

:

3-Bromo-2-methoxybenzonitrile

Description:
3-Bromo-2-methoxybenzonitrile is an organic compound characterized by its aromatic structure, which includes a bromine atom and a methoxy group attached to a benzene ring, along with a nitrile functional group. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and polarity. The methoxy group (-OCH3) enhances the electron-donating properties of the molecule, potentially affecting its solubility and reactivity in various chemical reactions. The nitrile group (-C≡N) is known for its strong dipole moment and can participate in nucleophilic addition reactions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of bromine and the nitrile group.
Formula:C8H6BrNO
InChI:InChI=1S/C8H6BrNO/c1-11-8-6(5-10)3-2-4-7(8)9/h2-4H,1H3
InChI key:ONHVKHDUTPBVBT-UHFFFAOYSA-N
SMILES:COC1=C(C=CC=C1Br)C#N
Found 4 products.