CAS 874473-32-2
:Pyrazinamine,N-[5-[2-(cyclohexyloxy)-6-methyl-4-pyrimidinyl]-2-thiazolyl]-5-[(4-methyl-1-piperazinyl)methyl]-, hydrochloride
Description:
Pyrazinamine, N-[5-[2-(cyclohexyloxy)-6-methyl-4-pyrimidinyl]-2-thiazolyl]-5-[(4-methyl-1-piperazinyl)methyl]-, hydrochloride, with CAS number 874473-32-2, is a chemical compound that exhibits properties typical of pharmaceutical agents. It is characterized by its complex molecular structure, which includes a pyrazinamine core, thiazole, and pyrimidine moieties, contributing to its potential biological activity. The presence of a cyclohexyloxy group and a piperazine derivative suggests that it may interact with various biological targets, possibly influencing neurotransmitter systems or exhibiting antimicrobial properties. As a hydrochloride salt, it is likely to be more soluble in water, enhancing its bioavailability for therapeutic applications. The compound's specific pharmacological effects, toxicity, and mechanism of action would require further investigation through experimental studies. Overall, this compound represents a class of molecules that may have significant implications in medicinal chemistry and drug development.
Formula:C24H32N8OSxClH
InChI:InChI=1S/C24H32N8OS.ClH/c1-17-12-20(29-23(28-17)33-19-6-4-3-5-7-19)21-14-27-24(34-21)30-22-15-25-18(13-26-22)16-32-10-8-31(2)9-11-32;/h12-15,19H,3-11,16H2,1-2H3,(H,26,27,30);1H
InChI key:QPHMUYWNZZFDFU-UHFFFAOYSA-N
SMILES:CC1=CC(=NC(=N1)OC2CCCCC2)C3=CN=C(S3)NC4=NC=C(N=C4)CN5CCN(CC5)C.Cl
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
5-(2-(Cyclohexyloxy)-6-methylpyrimidin-4-yl)-N-(5-((4-methylpiperazin-1-yl)methyl)pyrazin-2-yl)thiazol-2-amine-d8 Hydrochloride
CAS:Controlled ProductApplications 5-(2-(Cyclohexyloxy)-6-methylpyrimidin-4-yl)-N-(5-((4-methylpiperazin-1-yl)methyl)pyrazin-2-yl)thiazol-2-amine-d8 Hydrochloride is the labeled analogue of 5-(2-(Cyclohexyloxy)-6-methylpyrimidin-4-yl)-N-(5-((4-methylpiperazin-1-yl)methyl)pyrazin-2-yl)thiazol-2-amine Hydrochloride (C989830), a cyclin-dependent kinase (Cdk) 4/6 inhibitor.
References Hirai, H., et. al.: Cell Cycle, 9, 1590 (2010)Formula:C24H24D8N8OS·(ClH)Color and Shape:NeatMolecular weight:488.68 + x(36.46)5-(2-(Cyclohexyloxy)-6-methylpyrimidin-4-yl)-N-(5-((4-methylpiperazin-1-yl)methyl)pyrazin-2-yl)thiazol-2-amine Hydrochloride
CAS:Controlled ProductFormula:C24H32N8OS·(ClH)Color and Shape:Neat
