CymitQuimica logo

CAS 874583-32-1

:

1H-Indole-2-carboxylic acid,5-[2-[(methylamino)sulfonyl]ethyl]-3-(4-pyridinyl)-, methyl ester

Description:
1H-Indole-2-carboxylic acid, 5-[2-[(methylamino)sulfonyl]ethyl]-3-(4-pyridinyl)-, methyl ester, identified by CAS number 874583-32-1, is a complex organic compound characterized by its indole core structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of a methyl ester indicates that the carboxylic acid is esterified, enhancing its lipophilicity and potentially affecting its biological activity. Additionally, the compound contains a sulfonamide group, which is known for its pharmacological properties, and a pyridine ring, which can participate in various interactions due to its nitrogen atom. Overall, this compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. Its structural complexity suggests potential applications in pharmaceuticals, particularly in targeting specific biological pathways or receptors.
Formula:C18H19N3O4S
InChI:InChI=1S/C18H19N3O4S/c1-19-26(23,24)10-7-12-3-4-15-14(11-12)16(13-5-8-20-9-6-13)17(21-15)18(22)25-2/h3-6,8-9,11,19,21H,7,10H2,1-2H3
InChI key:IFJMJRSGQQOANI-UHFFFAOYSA-N
SMILES:CNS(=O)(=O)CCC1=CC2=C(C=C1)NC(=C2C3=CC=NC=C3)C(=O)OC
Found 1 products.