CymitQuimica logo

CAS 874758-86-8

:

2,2'-Bipyridine, 4,4'-di-1-pyrrolidinyl-

Description:
2,2'-Bipyridine, 4,4'-di-1-pyrrolidinyl- is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of two pyrrolidinyl groups at the 4 and 4' positions enhances its solubility and reactivity, making it a versatile ligand in coordination chemistry. This compound typically exhibits a high degree of planarity due to the aromatic nature of the bipyridine framework, which can facilitate π-π stacking interactions. Its nitrogen atoms can coordinate with metal ions, making it useful in various applications, including catalysis and the development of metal-organic frameworks. The compound is likely to be a solid at room temperature, with potential applications in organic synthesis and materials science. Safety data should be consulted for handling, as with many nitrogen-containing organic compounds, it may pose health risks if ingested or inhaled. Overall, its unique structural features contribute to its functionality in chemical processes.
Formula:C18H22N4
InChI:InChI=1S/C18H22N4/c1-2-10-21(9-1)15-5-7-19-17(13-15)18-14-16(6-8-20-18)22-11-3-4-12-22/h5-8,13-14H,1-4,9-12H2
InChI key:PMGICETZCRYDBB-UHFFFAOYSA-N
SMILES:C1CCN(C1)C2=CC(=NC=C2)C3=NC=CC(=C3)N4CCCC4
Found 3 products.