CymitQuimica logo

CAS 874801-60-2

:

1,1-Dimethylethyl 1,5,6,8-tetrahydro-4-oxopyrido[4′,3′:4,5]thieno[2,3-d]pyrimidine-7(4H)-carboxylate

Description:
1,1-Dimethylethyl 1,5,6,8-tetrahydro-4-oxopyrido[4′,3′:4,5]thieno[2,3-d]pyrimidine-7(4H)-carboxylate, with CAS number 874801-60-2, is a complex organic compound characterized by its unique bicyclic structure that incorporates both pyridine and thieno-pyrimidine moieties. This compound features a carboxylate functional group, which contributes to its potential reactivity and solubility in various solvents. The presence of the dimethyl group enhances its steric properties, potentially influencing its biological activity and interaction with other molecules. The tetrahydro configuration indicates that it possesses a saturated ring system, which may affect its stability and reactivity. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological properties, including anti-inflammatory or anticancer activities. The specific arrangement of functional groups and the overall molecular architecture can significantly impact the compound's behavior in biological systems, making it a subject of interest for further research and development in drug discovery.
Formula:C14H17N3O3S
InChI:InChI=1S/C14H17N3O3S/c1-14(2,3)20-13(19)17-5-4-8-9(6-17)21-12-10(8)11(18)15-7-16-12/h7H,4-6H2,1-3H3,(H,15,16,18)
InChI key:InChIKey=XXJZEGQEPZVPBH-UHFFFAOYSA-N
SMILES:O=C1C=2C3=C(SC2NC=N1)CN(C(OC(C)(C)C)=O)CC3
Synonyms:
  • 1,1-Dimethylethyl 1,5,6,8-tetrahydro-4-oxopyrido[4′,3′:4,5]thieno[2,3-d]pyrimidine-7(4H)-carboxylate
  • tert-Butyl 4-oxo-3,4,5,6,7,8-hexahydropyrido[4′,3′:4,5]thieno[2,3-d]pyrimidine-7-carboxylate
  • tert-Butyl4-oxo-3,5,6,8-tetrahydropyrido[4′,3′:4,5]thieno[2,3-d]pyrimidine-7(4H)-carboxylate
  • Pyrido[4′,3′:4,5]thieno[2,3-d]pyrimidine-7(4H)-carboxylic acid, 1,5,6,8-tetrahydro-4-oxo-, 1,1-dimethylethyl ester
Found 4 products.