CymitQuimica logo

CAS 874804-21-4

:

4-Bromo-2,6-difluorobenzenesulfonyl chloride

Description:
4-Bromo-2,6-difluorobenzenesulfonyl chloride is an organic compound characterized by its sulfonyl chloride functional group, which is known for its reactivity in various chemical reactions, particularly in the formation of sulfonamides and other derivatives. This compound features a benzene ring substituted with two fluorine atoms and one bromine atom, contributing to its unique electronic properties and potential applications in medicinal chemistry and material science. The presence of the sulfonyl chloride group enhances its utility as a versatile reagent in organic synthesis. It is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions, although it can be sensitive to moisture and should be handled with care due to its reactive nature. The compound's molecular structure allows for various substitution reactions, making it valuable in the development of pharmaceuticals and agrochemicals. Safety precautions are essential when working with this compound, as sulfonyl chlorides can release toxic gases upon hydrolysis.
Formula:C6H2BrClF2O2S
InChI:InChI=1S/C6H2BrClF2O2S/c7-3-1-4(9)6(5(10)2-3)13(8,11)12/h1-2H
InChI key:InChIKey=UMDYPUFAKPKDSC-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C1=C(F)C=C(Br)C=C1F
Synonyms:
  • 4-Bromo-2,6-difluorobenzene-1-sulfonyl chloride
  • Benzenesulfonyl chloride, 4-bromo-2,6-difluoro-
  • 4-Bromo-2,6-difluorobenzenesulfonyl chloride
Found 5 products.