CAS 874817-93-3

Formula: C7H4ClIO2

InChI: InChI=1S/C7H4ClIO2/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3H,(H,10,11)

InChI key: RHDAGVGRAVWMOP-UHFFFAOYSA-N

SMILES: C1=CC(=C(C(=C1)I)Cl)C(=O)O

2-Chloro-3-iodobenzoic acid

CAS: 874817-93-3

2-Chloro-3-iodobenzoic acid

Formula: C₇H₄ClIO₂

Purity: 95%

Molecular weight: 282.464

Ref: 54-OR74263

2-Chloro-3-iodobenzoic acid

CAS: 874817-93-3

Formula: C₇H₄ClIO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 282.4629

Ref: IN-DA003AD2

2-Chloro-3-iodobenzoic acid

CAS: 874817-93-3

2-Chloro-3-iodobenzoic acid

Formula: C₇H₄ClIO₂

Purity: 95%

Molecular weight: 282.46

Ref: IN-DG221986

Empagliflozin Impurity 71

CAS: 874817-93-3

Formula: C₇H₄ClIO₂

Molecular weight: 282.46

Ref: 4Z-E-6389

2-Chloro-3-iodobenzoic acid

CAS: 874817-93-3

Formula: C₇H₄ClIO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 282.46

Ref: 10-F445837