CymitQuimica logo

CAS 874840-87-6

:

7-Iodo-2H-1,4-benzoxazin-3(4H)-one

Description:
7-Iodo-2H-1,4-benzoxazin-3(4H)-one is a chemical compound characterized by its unique structure, which includes a benzoxazine ring system with an iodine substituent at the 7-position. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and reactivity due to the presence of the iodine atom, which can influence its interaction with other molecules. The benzoxazine moiety is known for its applications in materials science and medicinal chemistry, often serving as a precursor for various derivatives. The compound may display solubility in organic solvents, and its reactivity can be influenced by the presence of functional groups in its structure. Additionally, the iodine atom can impart specific properties, such as increased lipophilicity and potential for halogen bonding. Overall, 7-Iodo-2H-1,4-benzoxazin-3(4H)-one is of interest for its potential applications in pharmaceuticals and as a building block in organic synthesis.
Formula:C8H6INO2
InChI:InChI=1S/C8H6INO2/c9-5-1-2-6-7(3-5)12-4-8(11)10-6/h1-3H,4H2,(H,10,11)
InChI key:RNGWLYQJCXPBKZ-UHFFFAOYSA-N
SMILES:C1C(=O)NC2=C(O1)C=C(C=C2)I
Found 4 products.