CymitQuimica logo

CAS 874908-11-9

:

Benzoic acid,4-[2-[[1-(2-aminophenyl)-3-methylbutyl]amino]-2-oxoethyl]-2-ethoxy-

Description:
Benzoic acid, 4-[2-[[1-(2-aminophenyl)-3-methylbutyl]amino]-2-oxoethyl]-2-ethoxy- is a complex organic compound characterized by its benzoic acid core, which is a carboxylic acid known for its antimicrobial properties and use as a food preservative. The presence of an ethoxy group and a substituted amino group contributes to its potential biological activity and solubility characteristics. The compound features a 2-oxoethyl moiety, which may enhance its reactivity and interaction with biological targets. Its structure suggests potential applications in pharmaceuticals, particularly in drug design, due to the presence of the amino group that can participate in hydrogen bonding and other interactions. The CAS number 874908-11-9 uniquely identifies this compound, facilitating its recognition in chemical databases and literature. Overall, this substance's unique functional groups and structural features may confer specific properties that are of interest in medicinal chemistry and related fields.
Formula:C22H28N2O4
InChI:InChI=1S/C22H28N2O4/c1-4-28-20-12-15(9-10-17(20)22(26)27)13-21(25)24-19(11-14(2)3)16-7-5-6-8-18(16)23/h5-10,12,14,19H,4,11,13,23H2,1-3H3,(H,24,25)(H,26,27)
InChI key:OSCVKZCOJUTUFD-UHFFFAOYSA-N
SMILES:CCOC1=C(C=CC(=C1)CC(=O)NC(CC(C)C)C2=CC=CC=C2N)C(=O)O
Found 5 products.