CAS 874908-14-2
:2-Ethoxy-4-[2-[[1-[2-(3-hydroxy-1-piperidinyl)phenyl]-3-methylbutyl]amino]-2-oxoethyl]benzoic acid
Description:
2-Ethoxy-4-[2-[[1-[2-(3-hydroxy-1-piperidinyl)phenyl]-3-methylbutyl]amino]-2-oxoethyl]benzoic acid, with CAS number 874908-14-2, is a synthetic organic compound characterized by its complex structure, which includes an ethoxy group, a benzoic acid moiety, and a piperidine derivative. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its structural features, which may interact with biological targets. The presence of the piperidine ring suggests possible pharmacological applications, particularly in medicinal chemistry, where such compounds are often explored for their therapeutic potential. Additionally, the functional groups present in the molecule may contribute to its reactivity and stability under various conditions. As with many synthetic compounds, the specific characteristics, including melting point, boiling point, and spectral properties, would need to be determined through experimental methods or referenced from chemical databases for precise applications in research or industry.
Formula:C27H36N2O5
InChI:InChI=1S/C27H36N2O5/c1-4-34-25-15-19(11-12-22(25)27(32)33)16-26(31)28-23(14-18(2)3)21-9-5-6-10-24(21)29-13-7-8-20(30)17-29/h5-6,9-12,15,18,20,23,30H,4,7-8,13-14,16-17H2,1-3H3,(H,28,31)(H,32,33)
InChI key:InChIKey=OBMAZJVHPAVADF-UHFFFAOYSA-N
SMILES:C(NC(CC1=CC(OCC)=C(C(O)=O)C=C1)=O)(CC(C)C)C2=C(C=CC=C2)N3CC(O)CCC3
Synonyms:- Benzoic acid, 2-ethoxy-4-[2-[[1-[2-(3-hydroxy-1-piperidinyl)phenyl]-3-methylbutyl]amino]-2-oxoethyl]-
- 2-Ethoxy-4-[2-[[1-[2-(3-hydroxy-1-piperidinyl)phenyl]-3-methylbutyl]amino]-2-oxoethyl]benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Repaglinide M4 Metabolite (3'-Hydroxyl Repaglinide) (Mixture of Diastereomers)
CAS:Formula:C27H36N2O5Color and Shape:White To Off-White SolidMolecular weight:468.59Repaglinide M4 Metabolite-d7 (Mixture of Diastereomers)
CAS:Formula:C27H29D7N2O5Color and Shape:White To Off-White SolidMolecular weight:475.643’-Hydroxy Repaglinide (Mixture of Diastereomers)
CAS:Controlled Product<p>Applications A metabolite of Repaglinide (R144500).<br>References Jarvis, B., et al.: Drugs, 59, 891 (2000), Niemi, M., et al.: Clin. Pharmacol. Ther., 70, 58 (2001), Hatorp, V., et al.: Clin. Pharmacokinet., 41, 471 (2002), Walsky, R., et al.: Drug Metab. Dispos., 33, 413 (2005),<br></p>Formula:C27H36N2O5Color and Shape:NeatMolecular weight:468.593’-Hydroxy repaglinide (Mixture of diastereomers)
CAS:3’-Hydroxy repaglinide is a fine chemical that is used in the synthesis of other compounds and as a reagent. It is a versatile building block and can be used to synthesize complex compounds. 3’-Hydroxy repaglinide can also be used as a research chemical, speciality chemical, or useful scaffold in organic reactions. The CAS number for this compound is 874908-14-2.Formula:C27H36N2O5Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:468.59 g/mol3'-Hydroxy Repaglinide
CAS:'3'-Hydroxy Repaglinide, a CYP2C8 metabolite of Repaglinide, treats type II diabetes.Formula:C27H36N2O5Purity:98%Color and Shape:SolidMolecular weight:468.59



