CymitQuimica logo

CAS 874908-14-2

:

2-Ethoxy-4-[2-[[1-[2-(3-hydroxy-1-piperidinyl)phenyl]-3-methylbutyl]amino]-2-oxoethyl]benzoic acid

Description:
2-Ethoxy-4-[2-[[1-[2-(3-hydroxy-1-piperidinyl)phenyl]-3-methylbutyl]amino]-2-oxoethyl]benzoic acid, with CAS number 874908-14-2, is a synthetic organic compound characterized by its complex structure, which includes an ethoxy group, a benzoic acid moiety, and a piperidine derivative. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its structural features, which may interact with biological targets. The presence of the piperidine ring suggests possible pharmacological applications, particularly in medicinal chemistry, where such compounds are often explored for their therapeutic potential. Additionally, the functional groups present in the molecule may contribute to its reactivity and stability under various conditions. As with many synthetic compounds, the specific characteristics, including melting point, boiling point, and spectral properties, would need to be determined through experimental methods or referenced from chemical databases for precise applications in research or industry.
Formula:C27H36N2O5
InChI:InChI=1S/C27H36N2O5/c1-4-34-25-15-19(11-12-22(25)27(32)33)16-26(31)28-23(14-18(2)3)21-9-5-6-10-24(21)29-13-7-8-20(30)17-29/h5-6,9-12,15,18,20,23,30H,4,7-8,13-14,16-17H2,1-3H3,(H,28,31)(H,32,33)
InChI key:InChIKey=OBMAZJVHPAVADF-UHFFFAOYSA-N
SMILES:C(NC(CC1=CC(OCC)=C(C(O)=O)C=C1)=O)(CC(C)C)C2=C(C=CC=C2)N3CC(O)CCC3
Synonyms:
  • Benzoic acid, 2-ethoxy-4-[2-[[1-[2-(3-hydroxy-1-piperidinyl)phenyl]-3-methylbutyl]amino]-2-oxoethyl]-
  • 2-Ethoxy-4-[2-[[1-[2-(3-hydroxy-1-piperidinyl)phenyl]-3-methylbutyl]amino]-2-oxoethyl]benzoic acid
Found 9 products.