CymitQuimica logo

CAS 874945-31-0

:

L-Leucinamide,L-valyl-N-phenyl- (9CI)

Description:
L-Leucinamide, L-valyl-N-phenyl- (9CI), with the CAS number 874945-31-0, is a synthetic compound that belongs to the class of amino acid derivatives. It features a structure that incorporates the amino acids leucine and valine, along with a phenyl group, which contributes to its unique properties. This compound is characterized by its potential applications in pharmaceuticals and biochemistry, particularly in the development of peptide-based drugs or as a building block in organic synthesis. The presence of the amide functional group indicates that it may exhibit specific interactions in biological systems, such as enzyme activity modulation or receptor binding. Additionally, the compound's hydrophobic phenyl group may influence its solubility and permeability, making it relevant in drug formulation. While detailed toxicity and safety data may not be extensively documented, compounds of this nature typically require careful handling and assessment in laboratory settings. Overall, L-Leucinamide, L-valyl-N-phenyl- represents a noteworthy example of amino acid derivatives with potential utility in various scientific fields.
Formula:C17H27N3O2
InChI:InChI=1S/C17H27N3O2/c1-11(2)10-14(20-17(22)15(18)12(3)4)16(21)19-13-8-6-5-7-9-13/h5-9,11-12,14-15H,10,18H2,1-4H3,(H,19,21)(H,20,22)
InChI key:LODYUHYUFPJMPF-UHFFFAOYSA-N
SMILES:CC(C)CC(C(=O)NC1=CC=CC=C1)NC(=O)C(C(C)C)N
Synonyms:
  • L-Valinyl-L-Leucinyl Anilide
  • Val-L-leu-anilide
  • L-Valyl-N-phenyl-L-leucinamide
Found 1 products.