CAS 875-72-9

Formula: C11H16

InChI: InChI=1S/C11H16/c1-7-10-3-8-2-9(5-10)6-11(7)4-8/h8-11H,1-6H2

InChI key: JTCQPLINQYIRDZ-UHFFFAOYSA-N

SMILES: C=C1C2CC3CC(C2)CC1C3

2-Methylideneadamantane

CAS: 875-72-9

2-Methylideneadamantane is a molecule that has been shown to have patterning effects in some light-exposed samples. This compound can be used as a reactive functional group for polymerization initiators in the production of polymers and plastics. 2-Methylideneadamantane also has properties similar to an immunoassay, which are tests that measure the presence or concentration of a substance in blood or other bodily fluids. It is often used for the detection of chloride ions, immunoglobulins, and antigens. The compound is a colorless liquid with a strong odor and is soluble in water, alcohols, ethers, chloroform, carbon tetrachloride, and benzene. 2-Methylideneadamantane reacts with hydrochloric acid to form ethyl diazoacetate and hydrogen chloride gas. It reacts with ethyl diazoacetate to form methylenediadamantan

Formula: C₁₁H₁₆

Purity: Min. 95%

Molecular weight: 148.24 g/mol

Ref: 3D-AAA87572