CymitQuimica logo

CAS 875-94-5

:

4-Carboxylbenzocyclobutene

Description:
4-Carboxylbenzocyclobutene, with the CAS number 875-94-5, is an organic compound characterized by its unique bicyclic structure, which includes a benzene ring fused to a cyclobutene ring. This compound features a carboxylic acid functional group (-COOH) at the para position relative to the fusion point of the rings. The presence of the carboxyl group imparts acidic properties and enhances the compound's reactivity, making it useful in various chemical syntheses and applications. 4-Carboxylbenzocyclobutene is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its structural features contribute to its potential use in materials science, particularly in the development of polymers and resins. Additionally, the compound may participate in various chemical reactions, including esterification and amidation, which can be leveraged in organic synthesis. Overall, 4-Carboxylbenzocyclobutene is a versatile compound with significant implications in both academic research and industrial applications.
Formula:C9H8O2
InChI:InChI=1/C9H8O2/c10-9(11)8-4-2-6-1-3-7(6)5-8/h2,4-5H,1,3H2,(H,10,11)
InChI key:LOOOVFMUCRDVNN-UHFFFAOYSA-N
SMILES:C1Cc2cc(ccc12)C(=O)O
Synonyms:
  • Bicyclo[4.2.0]octa-1,3,5-triene-3-carboxylic acid
  • 4-Cbcb
  • 4-Carboxyl benzocyclobutene
Found 4 products.