CymitQuimica logo

CAS 875-97-8

:

2,4-Dioxo-5-thiazolidineacetic acid

Description:
2,4-Dioxo-5-thiazolidineacetic acid, with the CAS number 875-97-8, is a heterocyclic compound featuring a thiazolidine ring. This compound is characterized by the presence of two carbonyl groups (dioxo) and a thiazolidine structure, which contributes to its unique chemical properties. It typically exhibits a solid state at room temperature and is soluble in polar solvents due to the presence of functional groups that can engage in hydrogen bonding. The thiazolidine ring imparts certain biological activities, making it of interest in medicinal chemistry. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, due to its reactive carbonyl groups. Its potential applications span across pharmaceuticals and agrochemicals, where it may serve as an intermediate or active ingredient. As with many chemical substances, safety data should be consulted to understand its handling and toxicity profiles.
Formula:C5H5NO4S
InChI:InChI=1S/C5H5NO4S/c7-3(8)1-2-4(9)6-5(10)11-2/h2H,1H2,(H,7,8)(H,6,9,10)
InChI key:InChIKey=NYOCHSASHNVXRM-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1SC(=O)NC1=O
Synonyms:
  • (2,4-Dioxothiazolidin-5-yl)acetic acid
  • 2,4-Dioxo-5-thiazolidineacetic acid
  • 2-(2,4-Dioxo-1,3-thiazolidin-5-yl)acetic acid
  • 2-(2,4-Dioxothiazolidin-5-yl)acetic acid
  • 5-Thiazolidineacetic acid, 2,4-dioxo-
  • (2,4-Dioxo-1,3-thiazolidin-5-yl)acetic acid
Found 3 products.