CymitQuimica logo

CAS 875167-01-4

:

3-Chloro-5-(trifluoromethyl)benzenesulphonyl chloride

Description:
3-Chloro-5-(trifluoromethyl)benzenesulphonyl chloride, with the CAS number 875167-01-4, is a chemical compound characterized by its sulphonyl chloride functional group, which is known for its reactivity and utility in organic synthesis. This compound features a chlorobenzene ring substituted with a trifluoromethyl group and a sulphonyl chloride moiety, making it a potent electrophile. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, while the sulphonyl chloride group allows for nucleophilic substitution reactions, making it valuable in the synthesis of various pharmaceuticals and agrochemicals. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. Due to its reactive nature, it should be handled with care, as it can release toxic gases upon hydrolysis and may cause skin and respiratory irritation. Proper safety measures, including the use of personal protective equipment, are essential when working with this compound in a laboratory setting.
Formula:C7H3Cl2F3O2S
InChI:InChI=1S/C7H3Cl2F3O2S/c8-5-1-4(7(10,11)12)2-6(3-5)15(9,13)14/h1-3H
InChI key:JYUGVORTFRFETG-UHFFFAOYSA-N
SMILES:C1=C(C=C(C=C1S(=O)(=O)Cl)Cl)C(F)(F)F
Found 4 products.