CymitQuimica logo

CAS 87517-47-3

:

Butanoic acid, 4-azido-, methyl ester

Description:
Butanoic acid, 4-azido-, methyl ester, identified by CAS number 87517-47-3, is an organic compound characterized by the presence of both an azido group and an ester functional group. This compound features a butanoic acid backbone, which is a four-carbon carboxylic acid, modified by the introduction of an azido group (-N3) at the fourth carbon position. The methyl ester indicates that the carboxylic acid has been esterified with methanol, resulting in a methyl ester functional group. The azido group is known for its reactivity, particularly in click chemistry and as a precursor for various nitrogen-containing compounds. Butanoic acid derivatives typically exhibit properties such as moderate volatility and solubility in organic solvents, while the presence of the azido group can impart unique reactivity and potential applications in materials science and medicinal chemistry. Safety considerations are important due to the potential hazards associated with azido compounds, which can be explosive under certain conditions. Overall, this compound represents a versatile building block in organic synthesis.
Formula:C5H9N3O2
InChI:InChI=1S/C5H9N3O2/c1-10-5(9)3-2-4-7-8-6/h2-4H2,1H3
InChI key:DPCLJBYTRUAAHH-UHFFFAOYSA-N
SMILES:COC(=O)CCCN=[N+]=[N-]
Synonyms:
  • 4-Azidobutyric acid methyl ester
Found 4 products.