CymitQuimica logo

CAS 875237-46-0

:

2-hydroxy-4-methylthiazole-5-carboxylic acid

Description:
2-Hydroxy-4-methylthiazole-5-carboxylic acid, with the CAS number 875237-46-0, is a heterocyclic organic compound characterized by the presence of both a thiazole ring and carboxylic acid functional group. This compound features a hydroxyl group (-OH) and a methyl group (-CH3) attached to the thiazole ring, contributing to its unique chemical properties. The thiazole moiety imparts notable biological activity, often associated with various pharmacological effects. The carboxylic acid group enhances its solubility in polar solvents and can participate in acid-base reactions. This compound may exhibit potential applications in pharmaceuticals, agrochemicals, or as a biochemical probe due to its structural characteristics. Additionally, its stability and reactivity can be influenced by the presence of the hydroxyl and carboxylic acid groups, making it a subject of interest in synthetic chemistry and medicinal research. Overall, 2-hydroxy-4-methylthiazole-5-carboxylic acid represents a versatile compound with significant implications in various scientific fields.
Formula:C5H5NO3S
InChI:InChI=1/C5H5NO3S/c1-2-3(4(7)8)10-5(9)6-2/h1H3,(H,6,9)(H,7,8)
InChI key:NVHAAIMFHOSMHD-UHFFFAOYSA-N
SMILES:Cc1c(C(=O)O)sc(n1)O
Synonyms:
  • 2-Hydroxy-4-methyl-1,3-thiazole-5-carboxylic acid
  • 2-Hydroxy-4-methylthiazole-5-carboxylicacid
  • 5-Thiazolecarboxylic Acid, 2-Hydroxy-4-Methyl-
Found 4 products.