CAS 875288-77-0

4,7,10,13,16,19-Docosahexaenoic acid, methyl ester,(4E,7Z,10Z,13Z,16Z,19Z)-

Description:

4,7,10,13,16,19-Docosahexaenoic acid, methyl ester, commonly referred to as DHA methyl ester, is a methyl ester derivative of docosahexaenoic acid (DHA), an omega-3 fatty acid. This compound is characterized by its long carbon chain, consisting of 22 carbon atoms and six double bonds, which are in the cis configuration. The presence of multiple double bonds contributes to its unsaturated nature, making it a liquid at room temperature. DHA is known for its significant role in human health, particularly in brain and eye development, and is commonly found in fish oils and certain algae. The methyl ester form enhances its stability and solubility, making it useful in various applications, including dietary supplements and functional foods. Additionally, it can be utilized in research settings to study fatty acid metabolism and its effects on health. The compound's CAS number, 875288-77-0, uniquely identifies it in chemical databases, facilitating its recognition in scientific literature and regulatory contexts.

Formula: C₂₃H₃₄O₂

InChI: InChI=1S/C23H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)25-2/h4-5,7-8,10-11,13-14,16-17,19-20H,3,6,9,12,15,18,21-22H2,1-2H3/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19+

InChI key: VCDLWFYODNTQOT-UFDDNHIKSA-N

SMILES: CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C/CCC(=O)OC

Methyl 4(E),7(Z),10(Z),13(Z),16(Z),19(Z)-docosahexaenoate

CAS: 875288-77-0

Methyl 4(E),7(Z),10(Z),13(Z),16(Z),19(Z)-docosahexaenoate is a lipid employed in the production of lipid nanoparticles (LNP) for drug delivery purposes.

Formula: C₂₃H₃₄O₂

Molecular weight: 342.52

Ref: TM-TCL-02258

Methyl 4(E),7(Z),10(Z),13(Z),16(Z),19(Z)-Docosahexaenoate

CAS: 875288-77-0

Formula: C23H34O2

Purity: >98%

Color and Shape: In solution, Methanol

Molecular weight: 342.52

Ref: 48-20-2226