CymitQuimica logo

CAS 875306-94-8

:

Benzaldehyde, 4-cyclobutyl-

Description:
Benzaldehyde, 4-cyclobutyl- is an organic compound characterized by its aromatic aldehyde structure, featuring a benzene ring substituted with a cyclobutyl group at the para position relative to the aldehyde functional group. This compound typically exhibits a colorless to pale yellow liquid form with a distinctive almond-like odor, characteristic of benzaldehyde derivatives. Its molecular structure contributes to its reactivity, particularly in electrophilic aromatic substitution reactions. The presence of the cyclobutyl group can influence the compound's physical properties, such as boiling point and solubility, compared to other benzaldehyde derivatives. Benzaldehyde, 4-cyclobutyl- may also participate in various chemical reactions, including oxidation and condensation, making it of interest in synthetic organic chemistry. Additionally, its unique structure may impart specific biological activities, warranting investigation for potential applications in pharmaceuticals or agrochemicals. As with many organic compounds, safety precautions should be observed when handling this substance due to potential irritant properties.
Formula:C11H12O
InChI:InChI=1S/C11H12O/c12-8-9-4-6-11(7-5-9)10-2-1-3-10/h4-8,10H,1-3H2
InChI key:UBLPGLPKDLRMKI-UHFFFAOYSA-N
SMILES:C1CC(C1)C2=CC=C(C=C2)C=O
Found 4 products.