CymitQuimica logo

CAS 875515-76-7

:

4-chlorothieno[3,2-d]pyrimidine-6-carboxylic acid

Description:
4-Chlorothieno[3,2-d]pyrimidine-6-carboxylic acid is a heterocyclic compound characterized by its unique fused ring structure, which combines a thieno and pyrimidine moiety. This compound features a chlorine substituent at the 4-position of the thieno ring and a carboxylic acid functional group at the 6-position of the pyrimidine ring. The presence of these functional groups contributes to its potential reactivity and solubility in various solvents. Typically, compounds of this nature exhibit biological activity, making them of interest in medicinal chemistry and drug development. The thieno and pyrimidine rings can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which may be exploited for further synthetic applications. Additionally, the compound's structural features may influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion (ADME). Overall, 4-chlorothieno[3,2-d]pyrimidine-6-carboxylic acid represents a versatile scaffold for the development of novel therapeutic agents.
Formula:C7H3ClN2O2S
InChI:InChI=1/C7H3ClN2O2S/c8-6-5-3(9-2-10-6)1-4(13-5)7(11)12/h1-2H,(H,11,12)
InChI key:APAYWGOJUNTPCI-UHFFFAOYSA-N
SMILES:c1c2c(c(Cl)ncn2)sc1C(=O)O
Synonyms:
  • Thieno[3,2-d]pyrimidine-6-carboxylic acid, 4-chloro-
Found 5 products.