CymitQuimica logo

CAS 875664-38-3

:

1-Bromo-4,5-difluoro-2-methylbenzene

Description:
1-Bromo-4,5-difluoro-2-methylbenzene, also known as a substituted aromatic compound, features a benzene ring with three substituents: a bromine atom, two fluorine atoms, and a methyl group. The presence of these halogen atoms significantly influences its chemical properties, including reactivity and polarity. The bromine atom, being a larger and less electronegative halogen, can participate in nucleophilic substitution reactions, while the fluorine atoms, being highly electronegative, can enhance the compound's electrophilic character. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its state at room temperature. Its molecular structure suggests potential applications in organic synthesis and materials science, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the presence of multiple halogens may impart unique physical properties, such as increased density and boiling point compared to non-halogenated analogs. Safety precautions should be observed when handling this compound due to the potential hazards associated with bromine and fluorine.
Formula:C7H5BrF2
InChI:InChI=1S/C7H5BrF2/c1-4-2-6(9)7(10)3-5(4)8/h2-3H,1H3
InChI key:InChIKey=FKEURBCLFHOBDM-UHFFFAOYSA-N
SMILES:BrC1=C(C)C=C(F)C(F)=C1
Synonyms:
  • 1-Bromo-4,5-Difluoro-2-Methyl-Benzene
  • 1-Bromo-4,5-difluoro-2-methylbenzene
  • 4,5-Difluoro-2-methyl-1-bromobenzene
  • Benzene, 1-bromo-4,5-difluoro-2-methyl-
  • 2-Bromo-4,5-difluorotoluene
Found 5 products.