CymitQuimica logo

CAS 875685-44-2

:

9-Nitrooleic acid

Description:
9-Nitrooleic acid is a synthetic fatty acid derivative characterized by the presence of a nitro group at the ninth carbon of the oleic acid chain. This compound is typically a yellowish solid at room temperature and is soluble in organic solvents such as ethanol and dimethyl sulfoxide, but has limited solubility in water. The nitro group introduces unique chemical reactivity, making it useful in various biochemical applications, including studies of lipid metabolism and cell signaling. 9-Nitrooleic acid can influence cellular processes by modulating the activity of certain enzymes and receptors, thereby affecting inflammation and other physiological responses. Its structural features include a long hydrocarbon chain, which contributes to its amphiphilic nature, allowing it to interact with biological membranes. As with many nitro compounds, care should be taken in handling due to potential toxicity and environmental impact. Overall, 9-nitrooleic acid serves as a valuable tool in research, particularly in the fields of biochemistry and pharmacology.
Formula:C18H33NO4
InChI:InChI=1S/C18H33NO4/c1-2-3-4-5-6-8-11-14-17(19(22)23)15-12-9-7-10-13-16-18(20)21/h14H,2-13,15-16H2,1H3,(H,20,21)/b17-14+
InChI key:InChIKey=CQOAKBVRRVHWKV-SAPNQHFASA-N
SMILES:C(\CCCCCCCC(O)=O)(=C\CCCCCCCC)/N(=O)=O
Synonyms:
  • (E)-9-Nitro-octadec-9-enoic acid
  • 9-Nitrooleic acid
  • (9E)-9-Nitro-9-octadecenoic acid
  • 9-Octadecenoic acid, 9-nitro-, (9E)-
Found 4 products.