CymitQuimica logo

CAS 876-05-1

:

(1S,3R)-cyclopentane-1,3-dicarboxylic acid

Description:
(1S,3R)-cyclopentane-1,3-dicarboxylic acid, also known as cis-1,3-cyclopentanedicarboxylic acid, is a bicyclic organic compound characterized by the presence of two carboxylic acid functional groups attached to a cyclopentane ring. This compound exhibits a chiral nature due to the specific stereochemistry at the 1 and 3 positions, which contributes to its unique physical and chemical properties. It is typically a white crystalline solid at room temperature and is soluble in polar solvents such as water and alcohols, owing to the hydrophilic carboxylic acid groups. The compound can participate in various chemical reactions, including esterification and amidation, making it useful in organic synthesis and as a building block in the production of pharmaceuticals and agrochemicals. Its structural features also allow it to engage in intramolecular hydrogen bonding, which can influence its reactivity and stability. Overall, (1S,3R)-cyclopentane-1,3-dicarboxylic acid is an important compound in organic chemistry with applications in various fields.
Formula:C7H10O4
InChI:InChI=1S/C7H10O4/c8-6(9)4-1-2-5(3-4)7(10)11/h4-5H,1-3H2,(H,8,9)(H,10,11)/t4-,5+
InChI key:LNGJOYPCXLOTKL-SYDPRGILSA-N
SMILES:C1C[C@@H](C[C@@H]1C(=O)O)C(=O)O
Synonyms:
  • cis-1,3-Dicarboxycyclopentane
  • rel-(1R,3S)-1,3-Cyclopentanedicarboxylic acid
  • (1S,3R)-cyclopentane-1,3-dicarboxylic acid
  • 1,3-Cyclopentanedicarboxylic acid, (1R,3S)-rel-
  • cis-cyclopentane-1,3-dicarboxylic acid
  • (1R,3S)-CYCLOPENTANE-1,3-DICARBOXYLIC ACID
Found 6 products.