CymitQuimica logo

CAS 876-91-5

:

1H-Inden-1-one, 4-bromo-2,3-dihydro-6-methyl-

Description:
1H-Inden-1-one, 4-bromo-2,3-dihydro-6-methyl- is an organic compound characterized by its bicyclic structure, which includes an indene moiety with a ketone functional group. The presence of a bromine atom at the 4-position and a methyl group at the 6-position contributes to its unique reactivity and physical properties. This compound typically exhibits a pale yellow to brown appearance and is soluble in organic solvents. Its molecular structure allows for various chemical reactions, including electrophilic substitutions and nucleophilic additions, making it of interest in synthetic organic chemistry. The compound may also display biological activity, which can be explored for potential applications in pharmaceuticals or agrochemicals. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Proper safety protocols should be followed when working with this substance in laboratory settings.
Formula:C10H9BrO
InChI:InChI=1S/C10H9BrO/c1-6-4-8-7(9(11)5-6)2-3-10(8)12/h4-5H,2-3H2,1H3
InChI key:GEKKSKKTHXHXLU-UHFFFAOYSA-N
SMILES:CC1=CC2=C(CCC2=O)C(=C1)Br
Found 5 products.