CymitQuimica logo

CAS 87600-71-3

:

Methyl 4,6-dichloropyrimidine-5-carboxylate

Description:
Methyl 4,6-dichloropyrimidine-5-carboxylate is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions. This compound features two chlorine substituents at the 4 and 6 positions of the pyrimidine ring, contributing to its reactivity and potential biological activity. The presence of a carboxylate group, specifically a methyl ester at the 5 position, enhances its solubility in organic solvents and may influence its interactions in various chemical reactions. Methyl 4,6-dichloropyrimidine-5-carboxylate is often utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as an intermediate in the synthesis of more complex molecules. Its properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other functional groups in a reaction mixture. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.
Formula:C6H4Cl2N2O2
InChI:InChI=1S/C6H4Cl2N2O2/c1-12-6(11)3-4(7)9-2-10-5(3)8/h2H,1H3
InChI key:XPIOIPGYUJMJKX-UHFFFAOYSA-N
SMILES:COC(=O)C1=C(N=CN=C1Cl)Cl
Found 4 products.