CymitQuimica logo

CAS 876161-05-6

:

5-bromopyrazine-2-carboxylic acid

Description:
5-Bromopyrazine-2-carboxylic acid is a heterocyclic organic compound characterized by the presence of a pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 4 positions. The compound features a bromine substituent at the 5-position and a carboxylic acid group (-COOH) at the 2-position, contributing to its acidic properties. This structure imparts unique reactivity, making it useful in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. The presence of the bromine atom enhances the compound's electrophilicity, facilitating nucleophilic substitution reactions. Additionally, the carboxylic acid group can participate in hydrogen bonding, influencing solubility and reactivity in polar solvents. 5-Bromopyrazine-2-carboxylic acid is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its applications often extend to the synthesis of more complex molecules, where it serves as a key intermediate due to its functional groups.
Formula:C5H3BrN2O2
InChI:InChI=1/C5H3BrN2O2/c6-4-2-7-3(1-8-4)5(9)10/h1-2H,(H,9,10)
InChI key:NPJHCKULJAIWGV-UHFFFAOYSA-N
SMILES:c1c(C(=O)O)ncc(Br)n1
Synonyms:
  • 2-Pyrazinecarboxylic Acid, 5-Bromo-
  • 5-Bromo-2-Pyrazinecarboxylic Acid
Found 4 products.