CymitQuimica logo

CAS 876189-19-4

:

(4-methoxycarbonyl-3,5-dimethyl-phenyl)boronic acid

Description:
(4-Methoxycarbonyl-3,5-dimethyl-phenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a methoxycarbonyl group and two methyl groups, contributing to its unique reactivity and solubility properties. The presence of the boronic acid moiety allows for participation in Suzuki coupling reactions, a widely used method for forming carbon-carbon bonds. This compound is typically solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its structural features suggest potential applications in drug development and materials science, particularly in the synthesis of complex organic molecules. Additionally, the presence of the methoxycarbonyl group may influence its electronic properties and reactivity, making it a valuable compound for further research in synthetic chemistry.
Formula:C10H13BO4
InChI:InChI=1/C10H13BO4/c1-6-4-8(11(13)14)5-7(2)9(6)10(12)15-3/h4-5,13-14H,1-3H3
InChI key:PZRQLKHCAJPJDQ-UHFFFAOYSA-N
SMILES:Cc1cc(cc(C)c1C(=O)OC)B(O)O
Synonyms:
  • [4-(Methoxycarbonyl)-3,5-dimethylphenyl]boronic acid
  • Benzoic Acid, 4-Borono-2,6-Dimethyl-, Methyl Ester
Found 4 products.