CymitQuimica logo

CAS 876191-57-0

:

5-Isothiazolecarboxylic acid,4-[[(1,1-dimethylethoxy)carbonyl]amino]-3-methyl-

Description:
5-Isothiazolecarboxylic acid, 4-[[(1,1-dimethylethoxy)carbonyl]amino]-3-methyl- is a chemical compound characterized by its isothiazole ring structure, which contributes to its unique reactivity and properties. This compound features a carboxylic acid functional group, indicating its potential acidity and ability to participate in various chemical reactions, such as esterification or amidation. The presence of the 1,1-dimethylethoxycarbonyl group suggests that it may exhibit steric hindrance, influencing its reactivity and interactions with other molecules. Additionally, the methyl group at the 3-position of the isothiazole ring can affect the compound's solubility and stability. This compound may be of interest in pharmaceutical research due to its potential biological activity, as isothiazole derivatives are often explored for their antimicrobial, antifungal, and anticancer properties. Overall, the combination of functional groups and structural features makes this compound a subject of interest in synthetic organic chemistry and medicinal chemistry.
Formula:C10H14N2O4S
InChI:InChI=1S/C10H14N2O4S/c1-5-6(7(8(13)14)17-12-5)11-9(15)16-10(2,3)4/h1-4H3,(H,11,15)(H,13,14)
InChI key:VFOBPYOMFJEYMC-UHFFFAOYSA-N
SMILES:CC1=NSC(=C1NC(=O)OC(C)(C)C)C(=O)O
Found 2 products.