CymitQuimica logo

CAS 87630-35-1

:

1-(triisopropylsilyl)pyrrole

Description:
1-(Triisopropylsilyl)pyrrole is an organosilicon compound characterized by the presence of a pyrrole ring substituted with a triisopropylsilyl group. The triisopropylsilyl moiety enhances the compound's stability and solubility in organic solvents, making it useful in various synthetic applications. This compound typically exhibits a molecular formula that reflects its pyrrole structure, which consists of a five-membered aromatic ring containing nitrogen. The presence of the triisopropylsilyl group contributes to its unique reactivity and can influence its electronic properties, making it a valuable intermediate in organic synthesis, particularly in the preparation of more complex molecules. Additionally, the compound may exhibit interesting physical properties, such as a specific melting point and boiling point, which are influenced by the bulky silyl substituent. Its applications may extend to fields such as materials science, medicinal chemistry, and catalysis, where the manipulation of electronic and steric properties is crucial for the development of new compounds.
Formula:C13H25NSi
InChI:InChI=1/C13H25NSi/c1-11(2)15(12(3)4,13(5)6)14-9-7-8-10-14/h7-13H,1-6H3
InChI key:FBQURXLBJJNDBX-UHFFFAOYSA-N
SMILES:CC(C)[Si](C(C)C)(C(C)C)n1cccc1
Synonyms:
  • TIPS-pyrrole
  • 1-(tripropan-2-ylsilyl)-1H-pyrrole
Found 6 products.