CymitQuimica logo

CAS 876316-36-8

:

1-methyl-1H-indole-4-sulfonyl chloride

Description:
1-Methyl-1H-indole-4-sulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group attached to a methyl-substituted indole ring. This compound typically appears as a solid or liquid, depending on its purity and environmental conditions. It is known for its reactivity, particularly due to the presence of the sulfonyl chloride group, which can participate in nucleophilic substitution reactions, making it useful in organic synthesis, especially for the introduction of sulfonyl groups into various substrates. The indole moiety contributes to its potential biological activity, as indole derivatives are often found in pharmaceuticals and natural products. Additionally, this compound may exhibit properties such as solubility in organic solvents and stability under specific conditions, although it can be sensitive to moisture and should be handled with care. Overall, 1-methyl-1H-indole-4-sulfonyl chloride serves as a valuable intermediate in the synthesis of more complex chemical entities.
Formula:C9H8ClNO2S
InChI:InChI=1/C9H8ClNO2S/c1-11-6-5-7-8(11)3-2-4-9(7)14(10,12)13/h2-6H,1H3
InChI key:HFWFOJFQXZBLAU-UHFFFAOYSA-N
SMILES:Cn1ccc2c1cccc2S(=O)(=O)Cl
Found 5 products.