CAS 87666-57-7

[1,1':3',1''-Terphenyl]-2'-amine

Description:

[1,1':3',1''-Terphenyl]-2'-amine, with the CAS number 87666-57-7, is an organic compound characterized by its structure, which consists of three phenyl rings connected in a specific arrangement, with an amino group (-NH2) attached to one of the rings. This compound typically exhibits properties associated with aromatic compounds, such as stability and a tendency to participate in electrophilic substitution reactions. It is likely to be a solid at room temperature, with a relatively high melting point due to the strong π-π stacking interactions between the aromatic rings. The presence of the amino group can enhance its solubility in polar solvents and may also allow for hydrogen bonding. Additionally, [1,1':3',1''-Terphenyl]-2'-amine may have applications in organic electronics, such as in the development of organic light-emitting diodes (OLEDs) or as a precursor for other chemical syntheses. Its specific reactivity and applications would depend on the functional groups and the overall molecular structure.

Formula: C₁₈H₁₅N

InChI: InChI=1S/C18H15N/c19-18-16(14-8-3-1-4-9-14)12-7-13-17(18)15-10-5-2-6-11-15/h1-13H,19H2

InChI key: DSQMLISBVUTWJB-UHFFFAOYSA-N

SMILES: C1=CC=C(C=C1)C2=C(C(=CC=C2)C3=CC=CC=C3)N

[1,1':3',1''-Terphenyl]-2'-amine

CAS: 87666-57-7

[1,1':3',1''-Terphenyl]-2'-amine

Formula: C₁₈H₁₅N

Purity: >98%

Color and Shape: Solid

Molecular weight: 245.32

Ref: 54-OR91015

[1,1':3',1''-Terphenyl]-2'-amine

CAS: 87666-57-7

Formula: C₁₈H₁₅N

Purity: 99.9%

Color and Shape: Solid

Molecular weight: 245.3184

Ref: IN-DA00IEPU

[1,1':3',1''-Terphenyl]-2'-amine

CAS: 87666-57-7

Formula: C₁₈H₁₅N

Purity: 98%

Molecular weight: 245.325

Ref: 10-F337673

[1,1':3',1''-Terphenyl]-2'-amine

CAS: 87666-57-7

[1,1':3',1''-Terphenyl]-2'-amine

Formula: C₁₈H₁₅N

Purity: 95%

Molecular weight: 245.32

Ref: IN-DG261620