CAS 876717-29-2

1-[2-(2-methyl-1H-imidazol-1-yl)phenyl]methanamine

Description:

1-[2-(2-methyl-1H-imidazol-1-yl)phenyl]methanamine, with the CAS number 876717-29-2, is an organic compound characterized by its unique structure that includes an imidazole ring and an amine functional group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the amine group. The imidazole moiety may contribute to its biological activity, making it of interest in medicinal chemistry. The compound's molecular structure suggests it could participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the presence of the phenyl group may enhance its stability and lipophilicity, which can affect its pharmacokinetic properties. Overall, this compound's characteristics make it a candidate for further investigation in various chemical and pharmaceutical applications, particularly in the development of new therapeutic agents.

Formula: C₁₁H₁₃N₃

InChI: InChI=1/C11H13N3/c1-9-13-6-7-14(9)11-5-3-2-4-10(11)8-12/h2-7H,8,12H2,1H3

InChI key: JCHDRPRQPSKZQK-UHFFFAOYSA-N

SMILES: Cc1nccn1c1ccccc1CN

Synonyms:

• 2-(2-Methyl-imidazol-1-yl)-benzylamine
• benzenemethanamine, 2-(2-methyl-1H-imidazol-1-yl)-

2-(2-Methyl-1H-imidazol-1-yl)benzylamine

CAS: 876717-29-2

2-(2-Methyl-1H-imidazol-1-yl)benzylamine

Formula: C₁₁H₁₃N₃

Purity: 97%

Color and Shape: Liquid

Molecular weight: 187.24102

Ref: 54-OR12231

2-(2-Methyl-1H-imidazol-1-yl)benzylamine

CAS: 876717-29-2

Versatile small molecule scaffold

Formula: C₁₁H₁₃N₃

Purity: Min. 95%

Molecular weight: 187.24 g/mol

Ref: 3D-BKB71729