CymitQuimica logo

CAS 876717-32-7

:

N-Ethyl-1-methyl-4-piperidinamine

Description:
N-Ethyl-1-methyl-4-piperidinamine, identified by its CAS number 876717-32-7, is a chemical compound that belongs to the class of piperidine derivatives. It features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, with ethyl and methyl substituents that enhance its pharmacological properties. This compound is typically characterized by its amine functional group, which can participate in hydrogen bonding, influencing its solubility and reactivity. N-Ethyl-1-methyl-4-piperidinamine may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential interactions with various biological targets, which could lead to applications in therapeutic contexts. The compound's physical properties, such as boiling point, melting point, and solubility, would depend on its molecular structure and the presence of functional groups. As with many amines, it may also exhibit basicity, allowing it to form salts with acids. Safety and handling considerations are essential, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C8H18N2
InChI:InChI=1S/C8H18N2/c1-3-9-8-4-6-10(2)7-5-8/h8-9H,3-7H2,1-2H3
InChI key:GJCMPLHRWWWPHN-UHFFFAOYSA-N
SMILES:CCNC1CCN(CC1)C
Synonyms:
  • Ethyl-(1-Methyl-Piperidin-4-Yl)-Amine
  • Asinex-Reag Bas 10153293
  • 4-Piperidinamine, N-Ethyl-1-Methyl-
Found 3 products.