CymitQuimica logo

CAS 87674-20-2

:

2-Acetyl-3-fluoropyridine

Description:
2-Acetyl-3-fluoropyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features an acetyl group (-COCH3) and a fluorine atom attached to the pyridine ring, specifically at the 2 and 3 positions, respectively. It is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. The presence of the fluorine atom enhances its reactivity and can influence its chemical properties, such as polarity and solubility in various solvents. 2-Acetyl-3-fluoropyridine is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals and agrochemicals. Its unique structure allows for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Safety data should be consulted for handling, as it may pose health risks if inhaled or ingested.
Formula:C7H6FNO
InChI:InChI=1/C7H6FNO/c1-5(10)7-6(8)3-2-4-9-7/h2-4H,1H3
InChI key:CCZMVVFNNQQTFC-UHFFFAOYSA-N
SMILES:CC(=O)c1c(cccn1)F
Found 5 products.