CymitQuimica logo

CAS 87698-81-5

:

Pyrrolidine, 1-(2-bromophenyl)-

Description:
Pyrrolidine, 1-(2-bromophenyl)-, with the CAS number 87698-81-5, is a chemical compound characterized by its pyrrolidine ring, which is a five-membered saturated heterocyclic structure containing one nitrogen atom. The presence of a 2-bromophenyl group indicates that a bromine atom is substituted on the second position of a phenyl ring, which is attached to the nitrogen of the pyrrolidine. This compound typically exhibits properties such as being a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is likely to be soluble in organic solvents due to its aromatic and aliphatic components. Pyrrolidine derivatives often display interesting biological activities, making them of interest in medicinal chemistry. However, specific reactivity and stability can vary based on the substituents and the overall molecular structure. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C10H12BrN
InChI:InChI=1S/C10H12BrN/c11-9-5-1-2-6-10(9)12-7-3-4-8-12/h1-2,5-6H,3-4,7-8H2
InChI key:RSEPYQZONPBLLQ-UHFFFAOYSA-N
SMILES:C1CCN(C1)C2=CC=CC=C2Br
Synonyms:
  • 1-(2-Bromo-phenyl)-pyrrolidine
  • 1-(2-Bromophenyl)Pyrrolidine
Found 3 products.